About 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine
3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine (PubChem CID 143372747) has the molecular formula C19H17Cl2N7
and a molecular weight of 414.30 g/mol. Its IUPAC name is 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine |
| PubChem CID | 143372747 |
| Molecular Formula | C19H17Cl2N7 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine |
| SMILES | ClNc1ccc(CCn2cnc3c(Nc4cccc(NCl)c4)ncnc32)cc1 |
| InChI | InChI=1S/C19H17Cl2N7/c20-26-14-6-4-13(5-7-14)8-9-28-12-24-17-18(22-11-23-19(17)28)25-15-2-1-3-16(10-15)27-21/h1-7,10-12,26-27H,8-9H2,(H,22,23,25) |
| InChIKey | NMDZRSVAXROJEY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine?
The IUPAC name of 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine (CID 143372747) is 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine.
What is the SMILES notation for 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine?
The canonical SMILES for 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine is ClNc1ccc(CCn2cnc3c(Nc4cccc(NCl)c4)ncnc32)cc1.
What is the InChIKey of 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine?
The InChIKey is NMDZRSVAXROJEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17Cl2N7/c20-26-14-6-4-13(5-7-14)8-9-28-12-24-17-18(22-11-23-19(17)28)25-15-2-1-3-16(10-15)27-21/h1-7,10-12,26-27H,8-9H2,(H,22,23,25).
What are the key properties of 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine?
3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine has a molecular weight of 414.30 g/mol, XLogP of 4.94, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-N-chloro-1-N-[9-[2-[4-(chloroamino)phenyl]ethyl]purin-6-yl]benzene-1,3-diamine is sourced from PubChem (CID 143372747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).