About 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one
4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one (PubChem CID 143373063) has the molecular formula C28H27FN2O2
and a molecular weight of 442.53 g/mol. Its IUPAC name is 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one |
| PubChem CID | 143373063 |
| Molecular Formula | C28H27FN2O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one |
| SMILES | Nc1ccc(OC(Cc2ccc(F)cc2)c2cccc3ccccc23)cc1.O=C1CCCN1 |
| InChI | InChI=1S/C24H20FNO.C4H7NO/c25-19-10-8-17(9-11-19)16-24(27-21-14-12-20(26)13-15-21)23-7-3-5-18-4-1-2-6-22(18)23;6-4-2-1-3-5-4/h1-15,24H,16,26H2;1-3H2,(H,5,6) |
| InChIKey | DSLSAKKSSMIHST-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one?
The IUPAC name of 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one (CID 143373063) is 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one.
What is the SMILES notation for 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one?
The canonical SMILES for 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one is Nc1ccc(OC(Cc2ccc(F)cc2)c2cccc3ccccc23)cc1.O=C1CCCN1.
What is the InChIKey of 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one?
The InChIKey is DSLSAKKSSMIHST-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20FNO.C4H7NO/c25-19-10-8-17(9-11-19)16-24(27-21-14-12-20(26)13-15-21)23-7-3-5-18-4-1-2-6-22(18)23;6-4-2-1-3-5-4/h1-15,24H,16,26H2;1-3H2,(H,5,6).
What are the key properties of 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one?
4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one has a molecular weight of 442.53 g/mol, XLogP of 5.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-fluorophenyl)-1-naphthalen-1-ylethoxy]aniline;pyrrolidin-2-one is sourced from PubChem (CID 143373063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).