About 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol
1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol (PubChem CID 143373095) has the molecular formula C21H24F3NO2
and a molecular weight of 379.42 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol.
Molecular Properties
| Compound Name | 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol |
| PubChem CID | 143373095 |
| Molecular Formula | C21H24F3NO2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol |
| SMILES | CCCO.O=C1CCCN1C(Cc1ccc(F)c(F)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16F3NO.C3H8O/c19-14-6-4-13(5-7-14)17(22-9-1-2-18(22)23)11-12-3-8-15(20)16(21)10-12;1-2-3-4/h3-8,10,17H,1-2,9,11H2;4H,2-3H2,1H3 |
| InChIKey | ORSIFMNQELPADP-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol?
The IUPAC name of 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol (CID 143373095) is 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol.
What is the SMILES notation for 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol?
The canonical SMILES for 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol is CCCO.O=C1CCCN1C(Cc1ccc(F)c(F)c1)c1ccc(F)cc1.
What is the InChIKey of 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol?
The InChIKey is ORSIFMNQELPADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3NO.C3H8O/c19-14-6-4-13(5-7-14)17(22-9-1-2-18(22)23)11-12-3-8-15(20)16(21)10-12;1-2-3-4/h3-8,10,17H,1-2,9,11H2;4H,2-3H2,1H3.
What are the key properties of 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol?
1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol has a molecular weight of 379.42 g/mol, XLogP of 4.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-difluorophenyl)-1-(4-fluorophenyl)ethyl]pyrrolidin-2-one;propan-1-ol is sourced from PubChem (CID 143373095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).