About acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline
acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline (PubChem CID 143373878) has the molecular formula C20H29NO3
and a molecular weight of 331.46 g/mol. Its IUPAC name is acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline.
Molecular Properties
| Compound Name | acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline |
| PubChem CID | 143373878 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline |
| SMILES | CC.CC=O.CNc1ccc(Oc2cccc(OC(C)C)c2)cc1 |
| InChI | InChI=1S/C16H19NO2.C2H4O.C2H6/c1-12(2)18-15-5-4-6-16(11-15)19-14-9-7-13(17-3)8-10-14;1-2-3;1-2/h4-12,17H,1-3H3;2H,1H3;1-2H3 |
| InChIKey | FVGNTXGDDAQAPD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline?
The IUPAC name of acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline (CID 143373878) is acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline.
What is the SMILES notation for acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline?
The canonical SMILES for acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline is CC.CC=O.CNc1ccc(Oc2cccc(OC(C)C)c2)cc1.
What is the InChIKey of acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline?
The InChIKey is FVGNTXGDDAQAPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2.C2H4O.C2H6/c1-12(2)18-15-5-4-6-16(11-15)19-14-9-7-13(17-3)8-10-14;1-2-3;1-2/h4-12,17H,1-3H3;2H,1H3;1-2H3.
What are the key properties of acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline?
acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline has a molecular weight of 331.46 g/mol, XLogP of 5.54, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;ethane;N-methyl-4-(3-propan-2-yloxyphenoxy)aniline is sourced from PubChem (CID 143373878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).