About acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine
acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (PubChem CID 143374003) has the molecular formula C20H25N3S
and a molecular weight of 339.51 g/mol. Its IUPAC name is acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine.
Molecular Properties
| Compound Name | acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine |
| PubChem CID | 143374003 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine |
| SMILES | C#C.CS/C=C(\C)C1(c2ccc(-c3cn[nH]c3)cc2)CCNCC1 |
| InChI | InChI=1S/C18H23N3S.C2H2/c1-14(13-22-2)18(7-9-19-10-8-18)17-5-3-15(4-6-17)16-11-20-21-12-16;1-2/h3-6,11-13,19H,7-10H2,1-2H3,(H,20,21);1-2H/b14-13+; |
| InChIKey | FWRDGSPLEFKYMQ-IERUDJENSA-N |
| XLogP | 4.21 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine?
The IUPAC name of acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine (CID 143374003) is acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine.
What is the SMILES notation for acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine?
The canonical SMILES for acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine is C#C.CS/C=C(\C)C1(c2ccc(-c3cn[nH]c3)cc2)CCNCC1.
What is the InChIKey of acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine?
The InChIKey is FWRDGSPLEFKYMQ-IERUDJENSA-N. The full InChI is InChI=1S/C18H23N3S.C2H2/c1-14(13-22-2)18(7-9-19-10-8-18)17-5-3-15(4-6-17)16-11-20-21-12-16;1-2/h3-6,11-13,19H,7-10H2,1-2H3,(H,20,21);1-2H/b14-13+;.
What are the key properties of acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine?
acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine has a molecular weight of 339.51 g/mol, XLogP of 4.21, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;4-[(E)-1-methylsulfanylprop-1-en-2-yl]-4-[4-(1H-pyrazol-4-yl)phenyl]piperidine is sourced from PubChem (CID 143374003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).