C18H18IN3O — CID 143374140
1-(4-iodophenyl)-2-(methylamino)-1-[4-(1H-pyrazol-4-yl)phenyl]ethanol (PubChem CID 143374140) has the molecular formula C18H18IN3O and a molecular weight of 419.27 g/mol. Its IUPAC name is 1-(4-iodophenyl)-2-(methylamino)-1-[4-(1H-pyrazol-4-yl)phenyl]ethanol.
| Compound Name | 1-(4-iodophenyl)-2-(methylamino)-1-[4-(1H-pyrazol-4-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 143374140 |
| Molecular Formula | C18H18IN3O |
| Molecular Weight | 419.27 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 1-(4-iodophenyl)-2-(methylamino)-1-[4-(1H-pyrazol-4-yl)phenyl]ethanol |
| SMILES | CNCC(O)(c1ccc(I)cc1)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C18H18IN3O/c1-20-12-18(23,16-6-8-17(19)9-7-16)15-4-2-13(3-5-15)14-10-21-22-11-14/h2-11,20,23H,12H2,1H3,(H,21,22) |
| InChIKey | CYBAZQSLJHTXHB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|