About S-heptyl 2,5-dimethyloxane-4-carbothioate
S-heptyl 2,5-dimethyloxane-4-carbothioate (PubChem CID 143374600) has the molecular formula C15H28O2S
and a molecular weight of 272.45 g/mol. Its IUPAC name is S-heptyl 2,5-dimethyloxane-4-carbothioate.
Molecular Properties
| Compound Name | S-heptyl 2,5-dimethyloxane-4-carbothioate |
| PubChem CID | 143374600 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | S-heptyl 2,5-dimethyloxane-4-carbothioate |
| SMILES | CCCCCCCSC(=O)C1CC(C)OCC1C |
| InChI | InChI=1S/C15H28O2S/c1-4-5-6-7-8-9-18-15(16)14-10-13(3)17-11-12(14)2/h12-14H,4-11H2,1-3H3 |
| InChIKey | VNVHWBWFMONIAO-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-heptyl 2,5-dimethyloxane-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-heptyl 2,5-dimethyloxane-4-carbothioate?
The IUPAC name of S-heptyl 2,5-dimethyloxane-4-carbothioate (CID 143374600) is S-heptyl 2,5-dimethyloxane-4-carbothioate.
What is the SMILES notation for S-heptyl 2,5-dimethyloxane-4-carbothioate?
The canonical SMILES for S-heptyl 2,5-dimethyloxane-4-carbothioate is CCCCCCCSC(=O)C1CC(C)OCC1C.
What is the InChIKey of S-heptyl 2,5-dimethyloxane-4-carbothioate?
The InChIKey is VNVHWBWFMONIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2S/c1-4-5-6-7-8-9-18-15(16)14-10-13(3)17-11-12(14)2/h12-14H,4-11H2,1-3H3.
What are the key properties of S-heptyl 2,5-dimethyloxane-4-carbothioate?
S-heptyl 2,5-dimethyloxane-4-carbothioate has a molecular weight of 272.45 g/mol, XLogP of 4.28, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-heptyl 2,5-dimethyloxane-4-carbothioate is sourced from PubChem (CID 143374600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).