C19H27N3O2 — CID 143374825
N-(2-tert-butylfuro[2,3-b]pyridin-3-yl)azocane-1-carboxamide (PubChem CID 143374825) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is N-(2-tert-butylfuro[2,3-b]pyridin-3-yl)azocane-1-carboxamide.
| Compound Name | N-(2-tert-butylfuro[2,3-b]pyridin-3-yl)azocane-1-carboxamide |
|---|---|
| PubChem CID | 143374825 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | N-(2-tert-butylfuro[2,3-b]pyridin-3-yl)azocane-1-carboxamide |
| SMILES | CC(C)(C)c1oc2ncccc2c1NC(=O)N1CCCCCCC1 |
| InChI | InChI=1S/C19H27N3O2/c1-19(2,3)16-15(14-10-9-11-20-17(14)24-16)21-18(23)22-12-7-5-4-6-8-13-22/h9-11H,4-8,12-13H2,1-3H3,(H,21,23) |
| InChIKey | TYAXBVOQNMXJLY-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |