C11H13F3O — CID 143375499
(1E,3Z,6E)-4-ethenyl-1-(trifluoromethoxy)octa-1,3,6-triene (PubChem CID 143375499) has the molecular formula C11H13F3O and a molecular weight of 218.22 g/mol. Its IUPAC name is (1E,3Z,6E)-4-ethenyl-1-(trifluoromethoxy)octa-1,3,6-triene.
| Compound Name | (1E,3Z,6E)-4-ethenyl-1-(trifluoromethoxy)octa-1,3,6-triene |
|---|---|
| PubChem CID | 143375499 |
| Molecular Formula | C11H13F3O |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (1E,3Z,6E)-4-ethenyl-1-(trifluoromethoxy)octa-1,3,6-triene |
| SMILES | C=C/C(=C\C=C\OC(F)(F)F)C/C=C/C |
| InChI | InChI=1S/C11H13F3O/c1-3-5-7-10(4-2)8-6-9-15-11(12,13)14/h3-6,8-9H,2,7H2,1H3/b5-3+,9-6+,10-8+ |
| InChIKey | YFEQEJCIPAEJQR-QNGLDBALSA-N |
| XLogP | 4.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|