C27H36O6 — CID 14337575
methyl 3,4-diacetyloxy-5-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]benzoate (PubChem CID 14337575) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is methyl 3,4-diacetyloxy-5-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]benzoate.
| Compound Name | methyl 3,4-diacetyloxy-5-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 14337575 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 3,4-diacetyloxy-5-[(1,2,4a-trimethyl-5-methylidene-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methyl]benzoate |
| SMILES | C=C1CCCC2C1(C)CCC(C)C2(C)Cc1cc(C(=O)OC)cc(OC(C)=O)c1OC(C)=O |
| InChI | InChI=1S/C27H36O6/c1-16-9-8-10-23-26(16,5)12-11-17(2)27(23,6)15-21-13-20(25(30)31-7)14-22(32-18(3)28)24(21)33-19(4)29/h13-14,17,23H,1,8-12,15H2,2-7H3 |
| InChIKey | YBCLBOXMSYZSLC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|