About (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol
(2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol (PubChem CID 143375822) has the molecular formula C13H26N2O
and a molecular weight of 226.36 g/mol. Its IUPAC name is (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol.
Molecular Properties
| Compound Name | (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol |
| PubChem CID | 143375822 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol |
| SMILES | C=C(/C=C(\C)O)CNC(C)CCN(C)CC |
| InChI | InChI=1S/C13H26N2O/c1-6-15(5)8-7-12(3)14-10-11(2)9-13(4)16/h9,12,14,16H,2,6-8,10H2,1,3-5H3/b13-9+ |
| InChIKey | VPOGQSJGEZMNKU-UKTHLTGXSA-N |
| XLogP | 2.32 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol?
The IUPAC name of (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol (CID 143375822) is (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol.
What is the SMILES notation for (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol?
The canonical SMILES for (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol is C=C(/C=C(\C)O)CNC(C)CCN(C)CC.
What is the InChIKey of (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol?
The InChIKey is VPOGQSJGEZMNKU-UKTHLTGXSA-N. The full InChI is InChI=1S/C13H26N2O/c1-6-15(5)8-7-12(3)14-10-11(2)9-13(4)16/h9,12,14,16H,2,6-8,10H2,1,3-5H3/b13-9+.
What are the key properties of (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol?
(2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol has a molecular weight of 226.36 g/mol, XLogP of 2.32, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-[[4-[ethyl(methyl)amino]butan-2-ylamino]methyl]penta-2,4-dien-2-ol is sourced from PubChem (CID 143375822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).