C12H21NO2 — CID 143375881
(2E,3E)-2-ethylidene-N-(2-methoxyethyl)-3-methylhexa-3,5-dienamide;molecular hydrogen (PubChem CID 143375881) has the molecular formula C12H21NO2 and a molecular weight of 211.31 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-N-(2-methoxyethyl)-3-methylhexa-3,5-dienamide;molecular hydrogen.
| Compound Name | (2E,3E)-2-ethylidene-N-(2-methoxyethyl)-3-methylhexa-3,5-dienamide;molecular hydrogen |
|---|---|
| PubChem CID | 143375881 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | (2E,3E)-2-ethylidene-N-(2-methoxyethyl)-3-methylhexa-3,5-dienamide;molecular hydrogen |
| SMILES | C=C/C=C(C)/C(=C\C)C(=O)NCCOC.[H][H] |
| InChI | InChI=1S/C12H19NO2.H2/c1-5-7-10(3)11(6-2)12(14)13-8-9-15-4;/h5-7H,1,8-9H2,2-4H3,(H,13,14);1H/b10-7+,11-6+; |
| InChIKey | SFYBIZFCLDWAAO-WPMIGLRYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|