C28H41FN4 — CID 143376478
N'-[(1E,3E,4Z)-3-[1-(cyclopentylamino)ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]-N,N-dipropylethanimidamide (PubChem CID 143376478) has the molecular formula C28H41FN4 and a molecular weight of 452.66 g/mol. Its IUPAC name is N'-[(1E,3E,4Z)-3-[1-(cyclopentylamino)ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]-N,N-dipropylethanimidamide.
| Compound Name | N'-[(1E,3E,4Z)-3-[1-(cyclopentylamino)ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]-N,N-dipropylethanimidamide |
|---|---|
| PubChem CID | 143376478 |
| Molecular Formula | C28H41FN4 |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | N'-[(1E,3E,4Z)-3-[1-(cyclopentylamino)ethenylimino]-1-(4-fluorophenyl)-2-methylhexa-1,4-dienyl]-N,N-dipropylethanimidamide |
| SMILES | C=C(/N=C(\C=C/C)C(/C)=C(/N=C(\C)N(CCC)CCC)c1ccc(F)cc1)NC1CCCC1 |
| InChI | InChI=1S/C28H41FN4/c1-7-12-27(31-22(5)30-26-13-10-11-14-26)21(4)28(24-15-17-25(29)18-16-24)32-23(6)33(19-8-2)20-9-3/h7,12,15-18,26,30H,5,8-11,13-14,19-20H2,1-4,6H3/b12-7-,28-21+,31-27+,32-23+ |
| InChIKey | CYHWBQFRSKYPOZ-REDMILNJSA-N |
| XLogP | 7.12 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|