C24H41N3O4 — CID 143377128
2-[2-[2-[3-[(4-hydroxy-4-methylpentanoyl)amino]propyl]phenoxy]ethylamino]-N,3-dimethylpentanamide (PubChem CID 143377128) has the molecular formula C24H41N3O4 and a molecular weight of 435.61 g/mol. Its IUPAC name is 2-[2-[2-[3-[(4-hydroxy-4-methylpentanoyl)amino]propyl]phenoxy]ethylamino]-N,3-dimethylpentanamide.
| Compound Name | 2-[2-[2-[3-[(4-hydroxy-4-methylpentanoyl)amino]propyl]phenoxy]ethylamino]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 143377128 |
| Molecular Formula | C24H41N3O4 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | 2-[2-[2-[3-[(4-hydroxy-4-methylpentanoyl)amino]propyl]phenoxy]ethylamino]-N,3-dimethylpentanamide |
| SMILES | CCC(C)C(NCCOc1ccccc1CCCNC(=O)CCC(C)(C)O)C(=O)NC |
| InChI | InChI=1S/C24H41N3O4/c1-6-18(2)22(23(29)25-5)27-16-17-31-20-12-8-7-10-19(20)11-9-15-26-21(28)13-14-24(3,4)30/h7-8,10,12,18,22,27,30H,6,9,11,13-17H2,1-5H3,(H,25,29)(H,26,28) |
| InChIKey | QEVQIUNPKIVPAA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|