About (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene
(2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene (PubChem CID 143377507) has the molecular formula C15H31NO2S
and a molecular weight of 289.49 g/mol. Its IUPAC name is (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene.
Molecular Properties
| Compound Name | (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene |
| PubChem CID | 143377507 |
| Molecular Formula | C15H31NO2S |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene |
| SMILES | C/C=C(\C=C/CC)S(=O)(=O)NCCCC.C=C.CC |
| InChI | InChI=1S/C11H21NO2S.C2H6.C2H4/c1-4-7-9-11(6-3)15(13,14)12-10-8-5-2;2*1-2/h6-7,9,12H,4-5,8,10H2,1-3H3;1-2H3;1-2H2/b9-7-,11-6+;; |
| InChIKey | KCIOHZSTNNWNMD-USHZCZBWSA-N |
| XLogP | 4.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene?
The IUPAC name of (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene (CID 143377507) is (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene.
What is the SMILES notation for (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene?
The canonical SMILES for (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene is C/C=C(\C=C/CC)S(=O)(=O)NCCCC.C=C.CC.
What is the InChIKey of (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene?
The InChIKey is KCIOHZSTNNWNMD-USHZCZBWSA-N. The full InChI is InChI=1S/C11H21NO2S.C2H6.C2H4/c1-4-7-9-11(6-3)15(13,14)12-10-8-5-2;2*1-2/h6-7,9,12H,4-5,8,10H2,1-3H3;1-2H3;1-2H2/b9-7-,11-6+;;.
What are the key properties of (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene?
(2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene has a molecular weight of 289.49 g/mol, XLogP of 4.40, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-N-butylhepta-2,4-diene-3-sulfonamide;ethane;ethene is sourced from PubChem (CID 143377507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).