C19H40N2 — CID 143377671
3,5-dimethyl-1-(1-methylpyrrolidin-3-yl)piperidine;heptane (PubChem CID 143377671) has the molecular formula C19H40N2 and a molecular weight of 296.54 g/mol. Its IUPAC name is 3,5-dimethyl-1-(1-methylpyrrolidin-3-yl)piperidine;heptane.
| Compound Name | 3,5-dimethyl-1-(1-methylpyrrolidin-3-yl)piperidine;heptane |
|---|---|
| PubChem CID | 143377671 |
| Molecular Formula | C19H40N2 |
| Molecular Weight | 296.54 g/mol |
| Exact Mass | 296.32 |
| IUPAC Name | 3,5-dimethyl-1-(1-methylpyrrolidin-3-yl)piperidine;heptane |
| SMILES | CC1CC(C)CN(C2CCN(C)C2)C1.CCCCCCC |
| InChI | InChI=1S/C12H24N2.C7H16/c1-10-6-11(2)8-14(7-10)12-4-5-13(3)9-12;1-3-5-7-6-4-2/h10-12H,4-9H2,1-3H3;3-7H2,1-2H3 |
| InChIKey | OAJXZLMZRFXSNV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.54 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|