About N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine
N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine (PubChem CID 143377913) has the molecular formula C15H28N2
and a molecular weight of 236.40 g/mol. Its IUPAC name is N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine.
Molecular Properties
| Compound Name | N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine |
| PubChem CID | 143377913 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine |
| SMILES | CCCC(CCC)NCC1=CN=CCCC1C |
| InChI | InChI=1S/C15H28N2/c1-4-7-15(8-5-2)17-12-14-11-16-10-6-9-13(14)3/h10-11,13,15,17H,4-9,12H2,1-3H3 |
| InChIKey | OIXRKPQPZPKUPB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine?
The IUPAC name of N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine (CID 143377913) is N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine.
What is the SMILES notation for N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine?
The canonical SMILES for N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine is CCCC(CCC)NCC1=CN=CCCC1C.
What is the InChIKey of N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine?
The InChIKey is OIXRKPQPZPKUPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28N2/c1-4-7-15(8-5-2)17-12-14-11-16-10-6-9-13(14)3/h10-11,13,15,17H,4-9,12H2,1-3H3.
What are the key properties of N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine?
N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine has a molecular weight of 236.40 g/mol, XLogP of 3.93, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-4,5-dihydro-3H-azepin-6-yl)methyl]heptan-4-amine is sourced from PubChem (CID 143377913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).