C16H20N2O — CID 14337792
(1R,2S,6R,7S)-1,10,10-trimethyl-4-pyridin-2-yl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 14337792) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is (1R,2S,6R,7S)-1,10,10-trimethyl-4-pyridin-2-yl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene.
| Compound Name | (1R,2S,6R,7S)-1,10,10-trimethyl-4-pyridin-2-yl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene |
|---|---|
| PubChem CID | 14337792 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (1R,2S,6R,7S)-1,10,10-trimethyl-4-pyridin-2-yl-3-oxa-5-azatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@H]1OC(c3ccccn3)=N[C@H]21 |
| InChI | InChI=1S/C16H20N2O/c1-15(2)10-7-8-16(15,3)13-12(10)18-14(19-13)11-6-4-5-9-17-11/h4-6,9-10,12-13H,7-8H2,1-3H3/t10-,12-,13-,16+/m1/s1 |
| InChIKey | VEKZGTRLRJDYIN-VSBTWAGUSA-N |
| XLogP | 3.05 |
| TPSA | 34.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |