C21H34N2S — CID 143378056
1-[(3E,5E)-5-(aminomethylidene)-3-methylocta-1,3-dien-6-yn-2-yl]sulfanyl-N,2-dimethyl-3-prop-1-en-2-ylhexan-2-amine (PubChem CID 143378056) has the molecular formula C21H34N2S and a molecular weight of 346.58 g/mol. Its IUPAC name is 1-[(3E,5E)-5-(aminomethylidene)-3-methylocta-1,3-dien-6-yn-2-yl]sulfanyl-N,2-dimethyl-3-prop-1-en-2-ylhexan-2-amine.
| Compound Name | 1-[(3E,5E)-5-(aminomethylidene)-3-methylocta-1,3-dien-6-yn-2-yl]sulfanyl-N,2-dimethyl-3-prop-1-en-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 143378056 |
| Molecular Formula | C21H34N2S |
| Molecular Weight | 346.58 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[(3E,5E)-5-(aminomethylidene)-3-methylocta-1,3-dien-6-yn-2-yl]sulfanyl-N,2-dimethyl-3-prop-1-en-2-ylhexan-2-amine |
| SMILES | C=C(SCC(C)(NC)C(CCC)C(=C)C)/C(C)=C/C(C#CC)=C\N |
| InChI | InChI=1S/C21H34N2S/c1-9-11-19(14-22)13-17(5)18(6)24-15-21(7,23-8)20(12-10-2)16(3)4/h13-14,20,23H,3,6,10,12,15,22H2,1-2,4-5,7-8H3/b17-13+,19-14- |
| InChIKey | QLCCPKQDUZZKOS-KGLWARJVSA-N |
| XLogP | 5.02 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|