C27H31N5OS2 — CID 143378638
(Z)-4-[(3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfinyl-3,5-dihydro-2H-1,4-diazepin-7-yl]-2-methylidenebut-3-enenitrile;ethane (PubChem CID 143378638) has the molecular formula C27H31N5OS2 and a molecular weight of 505.71 g/mol. Its IUPAC name is (Z)-4-[(3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfinyl-3,5-dihydro-2H-1,4-diazepin-7-yl]-2-methylidenebut-3-enenitrile;ethane.
| Compound Name | (Z)-4-[(3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfinyl-3,5-dihydro-2H-1,4-diazepin-7-yl]-2-methylidenebut-3-enenitrile;ethane |
|---|---|
| PubChem CID | 143378638 |
| Molecular Formula | C27H31N5OS2 |
| Molecular Weight | 505.71 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | (Z)-4-[(3R)-3-benzyl-1-(1H-imidazol-5-ylmethyl)-4-thiophen-2-ylsulfinyl-3,5-dihydro-2H-1,4-diazepin-7-yl]-2-methylidenebut-3-enenitrile;ethane |
| SMILES | C=C(C#N)/C=C\C1=CCN(S(=O)c2cccs2)[C@H](Cc2ccccc2)CN1Cc1cnc[nH]1.CC |
| InChI | InChI=1S/C25H25N5OS2.C2H6/c1-20(15-26)9-10-23-11-12-30(33(31)25-8-5-13-32-25)24(14-21-6-3-2-4-7-21)18-29(23)17-22-16-27-19-28-22;1-2/h2-11,13,16,19,24H,1,12,14,17-18H2,(H,27,28);1-2H3/b10-9-;/t24-,33?;/m1./s1 |
| InChIKey | YDEDQONCZNYSRY-KBGXPIDUSA-N |
| XLogP | 5.47 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|