C16H16F3NO2 — CID 143379307
(2E,3E)-2-ethylidene-3-[[6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]amino]hexa-3,5-dienoic acid (PubChem CID 143379307) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-3-[[6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]amino]hexa-3,5-dienoic acid.
| Compound Name | (2E,3E)-2-ethylidene-3-[[6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]amino]hexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 143379307 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (2E,3E)-2-ethylidene-3-[[6-(trifluoromethyl)cyclohepta-1,3,6-trien-1-yl]amino]hexa-3,5-dienoic acid |
| SMILES | C=C/C=C(NC1=CC=CCC(C(F)(F)F)=C1)\C(=C/C)C(=O)O |
| InChI | InChI=1S/C16H16F3NO2/c1-3-7-14(13(4-2)15(21)22)20-12-9-6-5-8-11(10-12)16(17,18)19/h3-7,9-10,20H,1,8H2,2H3,(H,21,22)/b13-4+,14-7+ |
| InChIKey | IEZJIIQQHMPSMV-NFTOMYTGSA-N |
| XLogP | 4.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|