C20H26F3NO2 — CID 143379447
ethane;N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide (PubChem CID 143379447) has the molecular formula C20H26F3NO2 and a molecular weight of 369.43 g/mol. Its IUPAC name is ethane;N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide.
| Compound Name | ethane;N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 143379447 |
| Molecular Formula | C20H26F3NO2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethane;N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
| SMILES | C=C/C=C(\C=C)N(CC)C(=O)c1ccc(C(C)(O)C(F)(F)F)cc1.CC |
| InChI | InChI=1S/C18H20F3NO2.C2H6/c1-5-8-15(6-2)22(7-3)16(23)13-9-11-14(12-10-13)17(4,24)18(19,20)21;1-2/h5-6,8-12,24H,1-2,7H2,3-4H3;1-2H3/b15-8+; |
| InChIKey | RFOOOMZTVRKCSB-TWNLEINFSA-N |
| XLogP | 5.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|