C18H20F3NO2 — CID 143379448
N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide (PubChem CID 143379448) has the molecular formula C18H20F3NO2 and a molecular weight of 339.36 g/mol. Its IUPAC name is N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide.
| Compound Name | N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 143379448 |
| Molecular Formula | C18H20F3NO2 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | N-ethyl-N-[(3E)-hexa-1,3,5-trien-3-yl]-4-(1,1,1-trifluoro-2-hydroxypropan-2-yl)benzamide |
| SMILES | C=C/C=C(\C=C)N(CC)C(=O)c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20F3NO2/c1-5-8-15(6-2)22(7-3)16(23)13-9-11-14(12-10-13)17(4,24)18(19,20)21/h5-6,8-12,24H,1-2,7H2,3-4H3/b15-8+ |
| InChIKey | IMXVQXPUTMFEPY-OVCLIPMQSA-N |
| XLogP | 4.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|