About 3,5-dimethyl-2H-pyrrole;ethane
3,5-dimethyl-2H-pyrrole;ethane (PubChem CID 143379550) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is 3,5-dimethyl-2H-pyrrole;ethane.
Molecular Properties
| Compound Name | 3,5-dimethyl-2H-pyrrole;ethane |
| PubChem CID | 143379550 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | 3,5-dimethyl-2H-pyrrole;ethane |
| SMILES | CC.CC1=CC(C)=NC1 |
| InChI | InChI=1S/C6H9N.C2H6/c1-5-3-6(2)7-4-5;1-2/h3H,4H2,1-2H3;1-2H3 |
| InChIKey | JHSGITWNGBPDNW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,5-dimethyl-2H-pyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-2H-pyrrole;ethane?
The IUPAC name of 3,5-dimethyl-2H-pyrrole;ethane (CID 143379550) is 3,5-dimethyl-2H-pyrrole;ethane.
What is the SMILES notation for 3,5-dimethyl-2H-pyrrole;ethane?
The canonical SMILES for 3,5-dimethyl-2H-pyrrole;ethane is CC.CC1=CC(C)=NC1.
What is the InChIKey of 3,5-dimethyl-2H-pyrrole;ethane?
The InChIKey is JHSGITWNGBPDNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N.C2H6/c1-5-3-6(2)7-4-5;1-2/h3H,4H2,1-2H3;1-2H3.
What are the key properties of 3,5-dimethyl-2H-pyrrole;ethane?
3,5-dimethyl-2H-pyrrole;ethane has a molecular weight of 125.21 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-2H-pyrrole;ethane is sourced from PubChem (CID 143379550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).