C27H39F3O — CID 143379628
ethane;1-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-4-methylcyclohexane;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]ethanone (PubChem CID 143379628) has the molecular formula C27H39F3O and a molecular weight of 436.60 g/mol. Its IUPAC name is ethane;1-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-4-methylcyclohexane;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]ethanone.
| Compound Name | ethane;1-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-4-methylcyclohexane;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 143379628 |
| Molecular Formula | C27H39F3O |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.30 |
| IUPAC Name | ethane;1-[(2Z,4Z)-hepta-2,4,6-trien-3-yl]-4-methylcyclohexane;1-[4-(1,1,1-trifluoropropan-2-yl)phenyl]ethanone |
| SMILES | C=C/C=C\C(=C/C)C1CCC(C)CC1.CC.CC(=O)c1ccc(C(C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H22.C11H11F3O.C2H6/c1-4-6-7-13(5-2)14-10-8-12(3)9-11-14;1-7(11(12,13)14)9-3-5-10(6-4-9)8(2)15;1-2/h4-7,12,14H,1,8-11H2,2-3H3;3-7H,1-2H3;1-2H3/b7-6-,13-5+;; |
| InChIKey | FEUYJWYHYLODNN-QHJHKYGQSA-N |
| XLogP | 9.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|