C30H42N2O — CID 143379924
(6R,10bS)-6-[(2E,4E)-5-methylhepta-2,4-dien-6-yn-2-yl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethene (PubChem CID 143379924) has the molecular formula C30H42N2O and a molecular weight of 446.68 g/mol. Its IUPAC name is (6R,10bS)-6-[(2E,4E)-5-methylhepta-2,4-dien-6-yn-2-yl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethene.
| Compound Name | (6R,10bS)-6-[(2E,4E)-5-methylhepta-2,4-dien-6-yn-2-yl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethene |
|---|---|
| PubChem CID | 143379924 |
| Molecular Formula | C30H42N2O |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | (6R,10bS)-6-[(2E,4E)-5-methylhepta-2,4-dien-6-yn-2-yl]-9-(3-piperidin-1-ylpropoxy)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethene |
| SMILES | C#C/C(C)=C/C=C(\C)[C@H]1CN2CCC[C@H]2c2cc(OCCCN3CCCCC3)ccc21.C=C |
| InChI | InChI=1S/C28H38N2O.C2H4/c1-4-22(2)11-12-23(3)27-21-30-18-8-10-28(30)26-20-24(13-14-25(26)27)31-19-9-17-29-15-6-5-7-16-29;1-2/h1,11-14,20,27-28H,5-10,15-19,21H2,2-3H3;1-2H2/b22-11+,23-12+;/t27-,28+;/m1./s1 |
| InChIKey | DAROFXFRUHYKND-UEPPJEGDSA-N |
| XLogP | 6.50 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|