C11H19NO — CID 143380093
4,5-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole;ethane (PubChem CID 143380093) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole;ethane.
| Compound Name | 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole;ethane |
|---|---|
| PubChem CID | 143380093 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 4,5-bis[(Z)-prop-1-enyl]-2,3-dihydro-1,3-oxazole;ethane |
| SMILES | C/C=C\C1=C(/C=C\C)OCN1.CC |
| InChI | InChI=1S/C9H13NO.C2H6/c1-3-5-8-9(6-4-2)11-7-10-8;1-2/h3-6,10H,7H2,1-2H3;1-2H3/b5-3-,6-4-; |
| InChIKey | PPJLPHSPAQTLQB-VIOUERSGSA-N |
| XLogP | 2.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |