C14H20N2 — CID 143380773
2-methylidene-4-[(3,3,6-trimethylcyclohexa-1,5-dien-1-yl)amino]butanenitrile (PubChem CID 143380773) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-methylidene-4-[(3,3,6-trimethylcyclohexa-1,5-dien-1-yl)amino]butanenitrile.
| Compound Name | 2-methylidene-4-[(3,3,6-trimethylcyclohexa-1,5-dien-1-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 143380773 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-methylidene-4-[(3,3,6-trimethylcyclohexa-1,5-dien-1-yl)amino]butanenitrile |
| SMILES | C=C(C#N)CCNC1=CC(C)(C)CC=C1C |
| InChI | InChI=1S/C14H20N2/c1-11(10-15)6-8-16-13-9-14(3,4)7-5-12(13)2/h5,9,16H,1,6-8H2,2-4H3 |
| InChIKey | PKKBVBHZVXXXGG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|