About 3-nitrooxypropyl heptanoate
3-nitrooxypropyl heptanoate (PubChem CID 143381439) has the molecular formula C10H19NO5
and a molecular weight of 233.26 g/mol. Its IUPAC name is 3-nitrooxypropyl heptanoate.
Molecular Properties
| Compound Name | 3-nitrooxypropyl heptanoate |
| PubChem CID | 143381439 |
| Molecular Formula | C10H19NO5 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 3-nitrooxypropyl heptanoate |
| SMILES | CCCCCCC(=O)OCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C10H19NO5/c1-2-3-4-5-7-10(12)15-8-6-9-16-11(13)14/h2-9H2,1H3 |
| InChIKey | WEJWXUAUGFVMJS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrooxypropyl heptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrooxypropyl heptanoate?
The IUPAC name of 3-nitrooxypropyl heptanoate (CID 143381439) is 3-nitrooxypropyl heptanoate.
What is the SMILES notation for 3-nitrooxypropyl heptanoate?
The canonical SMILES for 3-nitrooxypropyl heptanoate is CCCCCCC(=O)OCCCO[N+](=O)[O-].
What is the InChIKey of 3-nitrooxypropyl heptanoate?
The InChIKey is WEJWXUAUGFVMJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO5/c1-2-3-4-5-7-10(12)15-8-6-9-16-11(13)14/h2-9H2,1H3.
What are the key properties of 3-nitrooxypropyl heptanoate?
3-nitrooxypropyl heptanoate has a molecular weight of 233.26 g/mol, XLogP of 2.10, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrooxypropyl heptanoate is sourced from PubChem (CID 143381439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).