C19H21NO — CID 143382034
7-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methoxy-1,8a-dihydroquinoline (PubChem CID 143382034) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 7-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methoxy-1,8a-dihydroquinoline.
| Compound Name | 7-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methoxy-1,8a-dihydroquinoline |
|---|---|
| PubChem CID | 143382034 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 7-ethenyl-2-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-4-methoxy-1,8a-dihydroquinoline |
| SMILES | C=CC1=CC2NC(/C(C=C)=C/C=C\C)=CC(OC)=C2C=C1 |
| InChI | InChI=1S/C19H21NO/c1-5-8-9-15(7-3)17-13-19(21-4)16-11-10-14(6-2)12-18(16)20-17/h5-13,18,20H,2-3H2,1,4H3/b8-5-,15-9+ |
| InChIKey | ZSXAYLSYEFLITR-HAVFLYGMSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|