About ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne
ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne (PubChem CID 143382135) has the molecular formula C21H31NO2
and a molecular weight of 329.48 g/mol. Its IUPAC name is ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne.
Molecular Properties
| Compound Name | ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne |
| PubChem CID | 143382135 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne |
| SMILES | C#CC.C/C=C(/O)CCC/C=N/C(=C\CO)c1ccccc1.CC |
| InChI | InChI=1S/C16H21NO2.C3H4.C2H6/c1-2-15(19)10-6-7-12-17-16(11-13-18)14-8-4-3-5-9-14;1-3-2;1-2/h2-5,8-9,11-12,18-19H,6-7,10,13H2,1H3;1H,2H3;1-2H3/b15-2+,16-11-,17-12+;; |
| InChIKey | HPTAKPISBPQAJM-ZPYHHGOASA-N |
| XLogP | 5.39 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne?
The IUPAC name of ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne (CID 143382135) is ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne.
What is the SMILES notation for ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne?
The canonical SMILES for ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne is C#CC.C/C=C(/O)CCC/C=N/C(=C\CO)c1ccccc1.CC.
What is the InChIKey of ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne?
The InChIKey is HPTAKPISBPQAJM-ZPYHHGOASA-N. The full InChI is InChI=1S/C16H21NO2.C3H4.C2H6/c1-2-15(19)10-6-7-12-17-16(11-13-18)14-8-4-3-5-9-14;1-3-2;1-2/h2-5,8-9,11-12,18-19H,6-7,10,13H2,1H3;1H,2H3;1-2H3/b15-2+,16-11-,17-12+;;.
What are the key properties of ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne?
ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne has a molecular weight of 329.48 g/mol, XLogP of 5.39, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-7-[(Z)-3-hydroxy-1-phenylprop-1-enyl]iminohept-2-en-3-ol;prop-1-yne is sourced from PubChem (CID 143382135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).