About ethane;1-ethyl-1,3-diazinan-2-one
ethane;1-ethyl-1,3-diazinan-2-one (PubChem CID 143383021) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is ethane;1-ethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | ethane;1-ethyl-1,3-diazinan-2-one |
| PubChem CID | 143383021 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | ethane;1-ethyl-1,3-diazinan-2-one |
| SMILES | CC.CCN1CCCNC1=O |
| InChI | InChI=1S/C6H12N2O.C2H6/c1-2-8-5-3-4-7-6(8)9;1-2/h2-5H2,1H3,(H,7,9);1-2H3 |
| InChIKey | JRPDHVHASUKRQA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-1,3-diazinan-2-one?
The IUPAC name of ethane;1-ethyl-1,3-diazinan-2-one (CID 143383021) is ethane;1-ethyl-1,3-diazinan-2-one.
What is the SMILES notation for ethane;1-ethyl-1,3-diazinan-2-one?
The canonical SMILES for ethane;1-ethyl-1,3-diazinan-2-one is CC.CCN1CCCNC1=O.
What is the InChIKey of ethane;1-ethyl-1,3-diazinan-2-one?
The InChIKey is JRPDHVHASUKRQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.C2H6/c1-2-8-5-3-4-7-6(8)9;1-2/h2-5H2,1H3,(H,7,9);1-2H3.
What are the key properties of ethane;1-ethyl-1,3-diazinan-2-one?
ethane;1-ethyl-1,3-diazinan-2-one has a molecular weight of 158.24 g/mol, XLogP of 1.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-1,3-diazinan-2-one is sourced from PubChem (CID 143383021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).