C31H35F3N2O2 — CID 143383356
9-[[2-(trifluoromethoxy)phenyl]methyl]-6-(2,3,6-trimethyl-5-oxoheptyl)-5,6,7,8-tetrahydrocarbazole-3-carbonitrile (PubChem CID 143383356) has the molecular formula C31H35F3N2O2 and a molecular weight of 524.63 g/mol. Its IUPAC name is 9-[[2-(trifluoromethoxy)phenyl]methyl]-6-(2,3,6-trimethyl-5-oxoheptyl)-5,6,7,8-tetrahydrocarbazole-3-carbonitrile.
| Compound Name | 9-[[2-(trifluoromethoxy)phenyl]methyl]-6-(2,3,6-trimethyl-5-oxoheptyl)-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
|---|---|
| PubChem CID | 143383356 |
| Molecular Formula | C31H35F3N2O2 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | 9-[[2-(trifluoromethoxy)phenyl]methyl]-6-(2,3,6-trimethyl-5-oxoheptyl)-5,6,7,8-tetrahydrocarbazole-3-carbonitrile |
| SMILES | CC(C)C(=O)CC(C)C(C)CC1CCc2c(c3cc(C#N)ccc3n2Cc2ccccc2OC(F)(F)F)C1 |
| InChI | InChI=1S/C31H35F3N2O2/c1-19(2)29(37)14-21(4)20(3)13-22-9-11-27-25(15-22)26-16-23(17-35)10-12-28(26)36(27)18-24-7-5-6-8-30(24)38-31(32,33)34/h5-8,10,12,16,19-22H,9,11,13-15,18H2,1-4H3 |
| InChIKey | TYMMMNJWQUMARF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|