C12H23NS — CID 143383497
2-(2,3-dihydrothiophen-5-yl)azepane;ethane (PubChem CID 143383497) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is 2-(2,3-dihydrothiophen-5-yl)azepane;ethane.
| Compound Name | 2-(2,3-dihydrothiophen-5-yl)azepane;ethane |
|---|---|
| PubChem CID | 143383497 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | 2-(2,3-dihydrothiophen-5-yl)azepane;ethane |
| SMILES | C1=C(C2CCCCCN2)SCC1.CC |
| InChI | InChI=1S/C10H17NS.C2H6/c1-2-5-9(11-7-3-1)10-6-4-8-12-10;1-2/h6,9,11H,1-5,7-8H2;1-2H3 |
| InChIKey | QDIHNCYUISKMDC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |