C21H24N4O2S — CID 143383530
14-(methylsulfanylamino)-5-(2-morpholin-4-ylethylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 143383530) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 14-(methylsulfanylamino)-5-(2-morpholin-4-ylethylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 14-(methylsulfanylamino)-5-(2-morpholin-4-ylethylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 143383530 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 14-(methylsulfanylamino)-5-(2-morpholin-4-ylethylamino)-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | CSNc1ccc2ccc3ncc(NCCN4CCOCC4)cc3c(=O)c2c1 |
| InChI | InChI=1S/C21H24N4O2S/c1-28-24-16-4-2-15-3-5-20-19(21(26)18(15)12-16)13-17(14-23-20)22-6-7-25-8-10-27-11-9-25/h2-5,12-14,22,24H,6-11H2,1H3 |
| InChIKey | GQXPMHDYKDGFJQ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|