C27H21N3O — CID 143383562
14-[(3H-azepin-7-ylamino)methyl]-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one (PubChem CID 143383562) has the molecular formula C27H21N3O and a molecular weight of 403.49 g/mol. Its IUPAC name is 14-[(3H-azepin-7-ylamino)methyl]-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one.
| Compound Name | 14-[(3H-azepin-7-ylamino)methyl]-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 143383562 |
| Molecular Formula | C27H21N3O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 14-[(3H-azepin-7-ylamino)methyl]-5-phenyl-7-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaen-2-one |
| SMILES | O=c1c2cc(CNC3=CC=CCC=N3)ccc2ccc2ncc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C27H21N3O/c31-27-23-15-19(17-30-26-9-5-2-6-14-28-26)10-11-21(23)12-13-25-24(27)16-22(18-29-25)20-7-3-1-4-8-20/h1-5,7-16,18,30H,6,17H2 |
| InChIKey | GGAQYBFMDAOLIS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |