C17H28N2O — CID 143383579
ethane;N-(3-methylphenyl)-3-piperidin-1-ylpropanamide (PubChem CID 143383579) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is ethane;N-(3-methylphenyl)-3-piperidin-1-ylpropanamide.
| Compound Name | ethane;N-(3-methylphenyl)-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 143383579 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | ethane;N-(3-methylphenyl)-3-piperidin-1-ylpropanamide |
| SMILES | CC.Cc1cccc(NC(=O)CCN2CCCCC2)c1 |
| InChI | InChI=1S/C15H22N2O.C2H6/c1-13-6-5-7-14(12-13)16-15(18)8-11-17-9-3-2-4-10-17;1-2/h5-7,12H,2-4,8-11H2,1H3,(H,16,18);1-2H3 |
| InChIKey | FRBANGMPUQNMPY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |