2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid

C10H11N3O2 — CID 143383912

IUPAC2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid
SMILESCCc1nn(CC(=O)O)c2ncccc12
InChIInChI=1S/C10H11N3O2/c1-2-8-7-4-3-5-11-10(7)13(12-8)6-9(14)15/h3-5H,2,6H2,1H3,(H,14,15)
InChIKeyPPBLNTDQLKRMOE-UHFFFAOYSA-N
MW205.22 g/mol
LogP1.08
Rot. Bonds3

About 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid

2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid (PubChem CID 143383912) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid
PubChem CID143383912
Molecular FormulaC10H11N3O2
Molecular Weight205.22 g/mol
Exact Mass205.09
IUPAC Name2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid
SMILESCCc1nn(CC(=O)O)c2ncccc12
InChIInChI=1S/C10H11N3O2/c1-2-8-7-4-3-5-11-10(7)13(12-8)6-9(14)15/h3-5H,2,6H2,1H3,(H,14,15)
InChIKeyPPBLNTDQLKRMOE-UHFFFAOYSA-N
XLogP1.08
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.22
LogP ≤ 51.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid?
The IUPAC name of 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid (CID 143383912) is 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid.
What is the SMILES notation for 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid?
The canonical SMILES for 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid is CCc1nn(CC(=O)O)c2ncccc12.
What is the InChIKey of 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid?
The InChIKey is PPBLNTDQLKRMOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-2-8-7-4-3-5-11-10(7)13(12-8)6-9(14)15/h3-5H,2,6H2,1H3,(H,14,15).
What are the key properties of 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid?
2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid has a molecular weight of 205.22 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethylpyrazolo[3,4-b]pyridin-1-yl)acetic acid is sourced from PubChem (CID 143383912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).