C24H28ClFN6O2S — CID 143383916
1-[4-(4-chloro-2-fluoro-5-methoxyphenyl)-2-methylpiperazin-1-yl]-2-[(1E,4Z,6Z)-8-methyl-9-(1,3-thiazol-2-yl)-3,8-dihydro-1,2,4-triazonin-2-yl]ethanone (PubChem CID 143383916) has the molecular formula C24H28ClFN6O2S and a molecular weight of 519.05 g/mol. Its IUPAC name is 1-[4-(4-chloro-2-fluoro-5-methoxyphenyl)-2-methylpiperazin-1-yl]-2-[(1E,4Z,6Z)-8-methyl-9-(1,3-thiazol-2-yl)-3,8-dihydro-1,2,4-triazonin-2-yl]ethanone.
| Compound Name | 1-[4-(4-chloro-2-fluoro-5-methoxyphenyl)-2-methylpiperazin-1-yl]-2-[(1E,4Z,6Z)-8-methyl-9-(1,3-thiazol-2-yl)-3,8-dihydro-1,2,4-triazonin-2-yl]ethanone |
|---|---|
| PubChem CID | 143383916 |
| Molecular Formula | C24H28ClFN6O2S |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | 1-[4-(4-chloro-2-fluoro-5-methoxyphenyl)-2-methylpiperazin-1-yl]-2-[(1E,4Z,6Z)-8-methyl-9-(1,3-thiazol-2-yl)-3,8-dihydro-1,2,4-triazonin-2-yl]ethanone |
| SMILES | COc1cc(N2CCN(C(=O)CN3C/N=C\C=C/C(C)/C(c4nccs4)=N\3)C(C)C2)c(F)cc1Cl |
| InChI | InChI=1S/C24H28ClFN6O2S/c1-16-5-4-6-27-15-31(29-23(16)24-28-7-10-35-24)14-22(33)32-9-8-30(13-17(32)2)20-12-21(34-3)18(25)11-19(20)26/h4-7,10-12,16-17H,8-9,13-15H2,1-3H3/b5-4-,27-6-,29-23+ |
| InChIKey | MCVMJOZNFAWHIS-WNARUVKMSA-N |
| XLogP | 3.92 |
| TPSA | 73.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |