C18H18FNO2 — CID 143384047
methyl (E)-3-[3-[benzyl(methyl)amino]-5-fluorophenyl]prop-2-enoate (PubChem CID 143384047) has the molecular formula C18H18FNO2 and a molecular weight of 299.35 g/mol. Its IUPAC name is methyl (E)-3-[3-[benzyl(methyl)amino]-5-fluorophenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[benzyl(methyl)amino]-5-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 143384047 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | methyl (E)-3-[3-[benzyl(methyl)amino]-5-fluorophenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cc(F)cc(N(C)Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H18FNO2/c1-20(13-14-6-4-3-5-7-14)17-11-15(10-16(19)12-17)8-9-18(21)22-2/h3-12H,13H2,1-2H3/b9-8+ |
| InChIKey | PHZDBAQANDSGQJ-CMDGGOBGSA-N |
| XLogP | 3.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|