C25H24F3N3O5S — CID 143384319
N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-fluorobenzenesulfonamide;ethane (PubChem CID 143384319) has the molecular formula C25H24F3N3O5S and a molecular weight of 535.54 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-fluorobenzenesulfonamide;ethane.
| Compound Name | N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-fluorobenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 143384319 |
| Molecular Formula | C25H24F3N3O5S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | N-[2,4-difluoro-3-[5-(2-methoxyethoxy)-1H-pyrrolo[2,3-b]pyridine-3-carbonyl]phenyl]-4-fluorobenzenesulfonamide;ethane |
| SMILES | CC.COCCOc1cnc2[nH]cc(C(=O)c3c(F)ccc(NS(=O)(=O)c4ccc(F)cc4)c3F)c2c1 |
| InChI | InChI=1S/C23H18F3N3O5S.C2H6/c1-33-8-9-34-14-10-16-17(12-28-23(16)27-11-14)22(30)20-18(25)6-7-19(21(20)26)29-35(31,32)15-4-2-13(24)3-5-15;1-2/h2-7,10-12,29H,8-9H2,1H3,(H,27,28);1-2H3 |
| InChIKey | FGUPXPFHCIASFI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|