About 3,5-dimethyl-1,2,4-triazol-1-amine
3,5-dimethyl-1,2,4-triazol-1-amine (PubChem CID 14338436) has the molecular formula C4H8N4
and a molecular weight of 112.14 g/mol. Its IUPAC name is 3,5-dimethyl-1,2,4-triazol-1-amine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,2,4-triazol-1-amine |
| PubChem CID | 14338436 |
| Molecular Formula | C4H8N4 |
| Molecular Weight | 112.14 g/mol |
| Exact Mass | 112.07 |
| IUPAC Name | 3,5-dimethyl-1,2,4-triazol-1-amine |
| SMILES | Cc1nc(C)n(N)n1 |
| InChI | InChI=1S/C4H8N4/c1-3-6-4(2)8(5)7-3/h5H2,1-2H3 |
| InChIKey | YZVKTUICXPMMGA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-1,2,4-triazol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,2,4-triazol-1-amine?
The IUPAC name of 3,5-dimethyl-1,2,4-triazol-1-amine (CID 14338436) is 3,5-dimethyl-1,2,4-triazol-1-amine.
What is the SMILES notation for 3,5-dimethyl-1,2,4-triazol-1-amine?
The canonical SMILES for 3,5-dimethyl-1,2,4-triazol-1-amine is Cc1nc(C)n(N)n1.
What is the InChIKey of 3,5-dimethyl-1,2,4-triazol-1-amine?
The InChIKey is YZVKTUICXPMMGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4/c1-3-6-4(2)8(5)7-3/h5H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,2,4-triazol-1-amine?
3,5-dimethyl-1,2,4-triazol-1-amine has a molecular weight of 112.14 g/mol, XLogP of -0.39, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,2,4-triazol-1-amine is sourced from PubChem (CID 14338436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).