C22H39FN2O — CID 143384378
(Z,2E)-N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-4-methyl-2-propylidenehex-3-enamide (PubChem CID 143384378) has the molecular formula C22H39FN2O and a molecular weight of 366.57 g/mol. Its IUPAC name is (Z,2E)-N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-4-methyl-2-propylidenehex-3-enamide.
| Compound Name | (Z,2E)-N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-4-methyl-2-propylidenehex-3-enamide |
|---|---|
| PubChem CID | 143384378 |
| Molecular Formula | C22H39FN2O |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.30 |
| IUPAC Name | (Z,2E)-N-[[(3R,4S)-1-(3,3-dimethylbutyl)-3-fluoropiperidin-4-yl]methyl]-4-methyl-2-propylidenehex-3-enamide |
| SMILES | CC/C=C(\C=C(\C)CC)C(=O)NC[C@@H]1CCN(CCC(C)(C)C)C[C@@H]1F |
| InChI | InChI=1S/C22H39FN2O/c1-7-9-18(14-17(3)8-2)21(26)24-15-19-10-12-25(16-20(19)23)13-11-22(4,5)6/h9,14,19-20H,7-8,10-13,15-16H2,1-6H3,(H,24,26)/b17-14-,18-9+/t19-,20-/m0/s1 |
| InChIKey | LAFXSSRGCXDHEO-VYPATMEHSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|