C22H28N3OP — CID 143384652
2-[1-[[3-[3-(phosphanylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-2-yl]ethanol (PubChem CID 143384652) has the molecular formula C22H28N3OP and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-[1-[[3-[3-(phosphanylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[1-[[3-[3-(phosphanylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 143384652 |
| Molecular Formula | C22H28N3OP |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.20 |
| IUPAC Name | 2-[1-[[3-[3-(phosphanylmethyl)phenyl]-1H-pyrrolo[2,3-b]pyridin-2-yl]methyl]piperidin-2-yl]ethanol |
| SMILES | OCCC1CCCCN1Cc1[nH]c2ncccc2c1-c1cccc(CP)c1 |
| InChI | InChI=1S/C22H28N3OP/c26-12-9-18-7-1-2-11-25(18)14-20-21(17-6-3-5-16(13-17)15-27)19-8-4-10-23-22(19)24-20/h3-6,8,10,13,18,26H,1-2,7,9,11-12,14-15,27H2,(H,23,24) |
| InChIKey | CQJTZWZPRNSKID-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 52.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|