C16H18BrN2OP — CID 143384686
[(2Z,4E,6Z)-1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-4-methoxyocta-2,4,6-trien-3-yl]phosphane (PubChem CID 143384686) has the molecular formula C16H18BrN2OP and a molecular weight of 365.21 g/mol. Its IUPAC name is [(2Z,4E,6Z)-1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-4-methoxyocta-2,4,6-trien-3-yl]phosphane.
| Compound Name | [(2Z,4E,6Z)-1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-4-methoxyocta-2,4,6-trien-3-yl]phosphane |
|---|---|
| PubChem CID | 143384686 |
| Molecular Formula | C16H18BrN2OP |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | [(2Z,4E,6Z)-1-(5-bromo-1H-pyrrolo[2,3-b]pyridin-3-yl)-4-methoxyocta-2,4,6-trien-3-yl]phosphane |
| SMILES | C/C=C\C=C(OC)/C(P)=C/Cc1c[nH]c2ncc(Br)cc12 |
| InChI | InChI=1S/C16H18BrN2OP/c1-3-4-5-14(20-2)15(21)7-6-11-9-18-16-13(11)8-12(17)10-19-16/h3-5,7-10H,6,21H2,1-2H3,(H,18,19)/b4-3-,14-5+,15-7- |
| InChIKey | UTSLHQDGHOYOBT-YXBLOTJVSA-N |
| XLogP | 4.73 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|