About 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine
2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine (PubChem CID 143384987) has the molecular formula C22H30N2
and a molecular weight of 322.50 g/mol. Its IUPAC name is 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine.
Molecular Properties
| Compound Name | 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine |
| PubChem CID | 143384987 |
| Molecular Formula | C22H30N2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine |
| SMILES | C/C=C(/C=C/c1ccc(C)nc1)c1cccnc1C.CCC(C)C |
| InChI | InChI=1S/C17H18N2.C5H12/c1-4-16(17-6-5-11-18-14(17)3)10-9-15-8-7-13(2)19-12-15;1-4-5(2)3/h4-12H,1-3H3;5H,4H2,1-3H3/b10-9+,16-4-; |
| InChIKey | BLCKNFPBVCAENB-CQPNZNNLSA-N |
| XLogP | 6.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine?
The IUPAC name of 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine (CID 143384987) is 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine.
What is the SMILES notation for 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine?
The canonical SMILES for 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine is C/C=C(/C=C/c1ccc(C)nc1)c1cccnc1C.CCC(C)C.
What is the InChIKey of 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine?
The InChIKey is BLCKNFPBVCAENB-CQPNZNNLSA-N. The full InChI is InChI=1S/C17H18N2.C5H12/c1-4-16(17-6-5-11-18-14(17)3)10-9-15-8-7-13(2)19-12-15;1-4-5(2)3/h4-12H,1-3H3;5H,4H2,1-3H3/b10-9+,16-4-;.
What are the key properties of 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine?
2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine has a molecular weight of 322.50 g/mol, XLogP of 6.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;2-methyl-3-[(1E,3Z)-1-(6-methyl-3-pyridinyl)penta-1,3-dien-3-yl]pyridine is sourced from PubChem (CID 143384987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).