C22H17F3N2S — CID 143385418
1-benzyl-5-[5-(3-methylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole (PubChem CID 143385418) has the molecular formula C22H17F3N2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 1-benzyl-5-[5-(3-methylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-benzyl-5-[5-(3-methylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 143385418 |
| Molecular Formula | C22H17F3N2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 1-benzyl-5-[5-(3-methylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
| SMILES | Cc1cccc(-c2ccc(-c3cc(C(F)(F)F)nn3Cc3ccccc3)s2)c1 |
| InChI | InChI=1S/C22H17F3N2S/c1-15-6-5-9-17(12-15)19-10-11-20(28-19)18-13-21(22(23,24)25)26-27(18)14-16-7-3-2-4-8-16/h2-13H,14H2,1H3 |
| InChIKey | FOLSPXZMAQDFRV-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |