C19H16ClF3N2OS2 — CID 143385526
1-[(E)-1-chlorobut-2-en-2-yl]-5-[5-(3-methylsulfinylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole (PubChem CID 143385526) has the molecular formula C19H16ClF3N2OS2 and a molecular weight of 444.93 g/mol. Its IUPAC name is 1-[(E)-1-chlorobut-2-en-2-yl]-5-[5-(3-methylsulfinylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[(E)-1-chlorobut-2-en-2-yl]-5-[5-(3-methylsulfinylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 143385526 |
| Molecular Formula | C19H16ClF3N2OS2 |
| Molecular Weight | 444.93 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 1-[(E)-1-chlorobut-2-en-2-yl]-5-[5-(3-methylsulfinylphenyl)thiophen-2-yl]-3-(trifluoromethyl)pyrazole |
| SMILES | C/C=C(\CCl)n1nc(C(F)(F)F)cc1-c1ccc(-c2cccc(S(C)=O)c2)s1 |
| InChI | InChI=1S/C19H16ClF3N2OS2/c1-3-13(11-20)25-15(10-18(24-25)19(21,22)23)17-8-7-16(27-17)12-5-4-6-14(9-12)28(2)26/h3-10H,11H2,1-2H3/b13-3+ |
| InChIKey | GJJBASUQDBNEBV-QLKAYGNNSA-N |
| XLogP | 6.13 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.93 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|