About acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane
acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane (PubChem CID 143385673) has the molecular formula C16H22O2S2
and a molecular weight of 310.48 g/mol. Its IUPAC name is acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane.
Molecular Properties
| Compound Name | acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane |
| PubChem CID | 143385673 |
| Molecular Formula | C16H22O2S2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane |
| SMILES | C#C.C/C=C\C(=C/C)c1ccc(C(C)=O)s1.CS(C)=O |
| InChI | InChI=1S/C12H14OS.C2H6OS.C2H2/c1-4-6-10(5-2)12-8-7-11(14-12)9(3)13;1-4(2)3;1-2/h4-8H,1-3H3;1-2H3;1-2H/b6-4-,10-5+;; |
| InChIKey | KAJLAPRZOBIICZ-WOCXXKSBSA-N |
| XLogP | 4.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane?
The IUPAC name of acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane (CID 143385673) is acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane.
What is the SMILES notation for acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane?
The canonical SMILES for acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane is C#C.C/C=C\C(=C/C)c1ccc(C(C)=O)s1.CS(C)=O.
What is the InChIKey of acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane?
The InChIKey is KAJLAPRZOBIICZ-WOCXXKSBSA-N. The full InChI is InChI=1S/C12H14OS.C2H6OS.C2H2/c1-4-6-10(5-2)12-8-7-11(14-12)9(3)13;1-4(2)3;1-2/h4-8H,1-3H3;1-2H3;1-2H/b6-4-,10-5+;;.
What are the key properties of acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane?
acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane has a molecular weight of 310.48 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-[5-[(2E,4Z)-hexa-2,4-dien-3-yl]thiophen-2-yl]ethanone;methylsulfinylmethane is sourced from PubChem (CID 143385673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).