(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid

C6H5NO2S — CID 14338576

IUPAC(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1nccs1
InChIInChI=1S/C6H5NO2S/c8-6(9)2-1-5-7-3-4-10-5/h1-4H,(H,8,9)/b2-1+
InChIKeyPIWFCOHMNRSNNY-OWOJBTEDSA-N
MW155.18 g/mol
LogP1.24
Rot. Bonds2

About (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid

(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid (PubChem CID 14338576) has the molecular formula C6H5NO2S and a molecular weight of 155.18 g/mol. Its IUPAC name is (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid.

Molecular Properties

Compound Name(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid
PubChem CID14338576
Molecular FormulaC6H5NO2S
Molecular Weight155.18 g/mol
Exact Mass155.00
IUPAC Name(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid
SMILESO=C(O)/C=C/c1nccs1
InChIInChI=1S/C6H5NO2S/c8-6(9)2-1-5-7-3-4-10-5/h1-4H,(H,8,9)/b2-1+
InChIKeyPIWFCOHMNRSNNY-OWOJBTEDSA-N
XLogP1.24
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500155.18
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid?
The IUPAC name of (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid (CID 14338576) is (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid.
What is the SMILES notation for (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid?
The canonical SMILES for (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid is O=C(O)/C=C/c1nccs1.
What is the InChIKey of (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid?
The InChIKey is PIWFCOHMNRSNNY-OWOJBTEDSA-N. The full InChI is InChI=1S/C6H5NO2S/c8-6(9)2-1-5-7-3-4-10-5/h1-4H,(H,8,9)/b2-1+.
What are the key properties of (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid?
(E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid has a molecular weight of 155.18 g/mol, XLogP of 1.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(1,3-thiazol-2-yl)prop-2-enoic acid is sourced from PubChem (CID 14338576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).